About 2-(2-methanidylpropylamino)ethanol;phosphane;uranium
2-(2-methanidylpropylamino)ethanol;phosphane;uranium (PubChem CID 169191093) has the molecular formula C6H17NOPU-
and a molecular weight of 388.21 g/mol. Its IUPAC name is 2-(2-methanidylpropylamino)ethanol;phosphane;uranium.
Molecular Properties
| Compound Name | 2-(2-methanidylpropylamino)ethanol;phosphane;uranium |
| PubChem CID | 169191093 |
| Molecular Formula | C6H17NOPU- |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(2-methanidylpropylamino)ethanol;phosphane;uranium |
| SMILES | P.[CH2-]C(C)CNCCO.[U] |
| InChI | InChI=1S/C6H14NO.H3P.U/c1-6(2)5-7-3-4-8;;/h6-8H,1,3-5H2,2H3;1H3;/q-1;; |
| InChIKey | YVBFCQUNMCEGTM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methanidylpropylamino)ethanol;phosphane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methanidylpropylamino)ethanol;phosphane;uranium?
The IUPAC name of 2-(2-methanidylpropylamino)ethanol;phosphane;uranium (CID 169191093) is 2-(2-methanidylpropylamino)ethanol;phosphane;uranium.
What is the SMILES notation for 2-(2-methanidylpropylamino)ethanol;phosphane;uranium?
The canonical SMILES for 2-(2-methanidylpropylamino)ethanol;phosphane;uranium is P.[CH2-]C(C)CNCCO.[U].
What is the InChIKey of 2-(2-methanidylpropylamino)ethanol;phosphane;uranium?
The InChIKey is YVBFCQUNMCEGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NO.H3P.U/c1-6(2)5-7-3-4-8;;/h6-8H,1,3-5H2,2H3;1H3;/q-1;;.
What are the key properties of 2-(2-methanidylpropylamino)ethanol;phosphane;uranium?
2-(2-methanidylpropylamino)ethanol;phosphane;uranium has a molecular weight of 388.21 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methanidylpropylamino)ethanol;phosphane;uranium is sourced from PubChem (CID 169191093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).