About 2,3-dimethylbutanal;ethoxyethane
2,3-dimethylbutanal;ethoxyethane (PubChem CID 126485653) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is 2,3-dimethylbutanal;ethoxyethane.
Molecular Properties
| Compound Name | 2,3-dimethylbutanal;ethoxyethane |
| PubChem CID | 126485653 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | 2,3-dimethylbutanal;ethoxyethane |
| SMILES | CC(C)C(C)C=O.CCOCC |
| InChI | InChI=1S/C6H12O.C4H10O/c1-5(2)6(3)4-7;1-3-5-4-2/h4-6H,1-3H3;3-4H2,1-2H3 |
| InChIKey | HEMHPCKLRSIPQD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutanal;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutanal;ethoxyethane?
The IUPAC name of 2,3-dimethylbutanal;ethoxyethane (CID 126485653) is 2,3-dimethylbutanal;ethoxyethane.
What is the SMILES notation for 2,3-dimethylbutanal;ethoxyethane?
The canonical SMILES for 2,3-dimethylbutanal;ethoxyethane is CC(C)C(C)C=O.CCOCC.
What is the InChIKey of 2,3-dimethylbutanal;ethoxyethane?
The InChIKey is HEMHPCKLRSIPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C4H10O/c1-5(2)6(3)4-7;1-3-5-4-2/h4-6H,1-3H3;3-4H2,1-2H3.
What are the key properties of 2,3-dimethylbutanal;ethoxyethane?
2,3-dimethylbutanal;ethoxyethane has a molecular weight of 174.28 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutanal;ethoxyethane is sourced from PubChem (CID 126485653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).