About 2-aminobutanal;ethoxyethane
2-aminobutanal;ethoxyethane (PubChem CID 174799837) has the molecular formula C8H19NO2
and a molecular weight of 161.24 g/mol. Its IUPAC name is 2-aminobutanal;ethoxyethane.
Molecular Properties
| Compound Name | 2-aminobutanal;ethoxyethane |
| PubChem CID | 174799837 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2-aminobutanal;ethoxyethane |
| SMILES | CCC(N)C=O.CCOCC |
| InChI | InChI=1S/C4H9NO.C4H10O/c1-2-4(5)3-6;1-3-5-4-2/h3-4H,2,5H2,1H3;3-4H2,1-2H3 |
| InChIKey | WUEKPPNVWADCOF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobutanal;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanal;ethoxyethane?
The IUPAC name of 2-aminobutanal;ethoxyethane (CID 174799837) is 2-aminobutanal;ethoxyethane.
What is the SMILES notation for 2-aminobutanal;ethoxyethane?
The canonical SMILES for 2-aminobutanal;ethoxyethane is CCC(N)C=O.CCOCC.
What is the InChIKey of 2-aminobutanal;ethoxyethane?
The InChIKey is WUEKPPNVWADCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H10O/c1-2-4(5)3-6;1-3-5-4-2/h3-4H,2,5H2,1H3;3-4H2,1-2H3.
What are the key properties of 2-aminobutanal;ethoxyethane?
2-aminobutanal;ethoxyethane has a molecular weight of 161.24 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanal;ethoxyethane is sourced from PubChem (CID 174799837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).