C26H38OSi — CID 134940564
triethyl-[(Z,3S,4S)-2-methyl-4,7-diphenylhept-5-en-3-yl]oxysilane (PubChem CID 134940564) has the molecular formula C26H38OSi and a molecular weight of 394.68 g/mol. Its IUPAC name is triethyl-[(Z,3S,4S)-2-methyl-4,7-diphenylhept-5-en-3-yl]oxysilane.
| Compound Name | triethyl-[(Z,3S,4S)-2-methyl-4,7-diphenylhept-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 134940564 |
| Molecular Formula | C26H38OSi |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | triethyl-[(Z,3S,4S)-2-methyl-4,7-diphenylhept-5-en-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H](/C=C\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H38OSi/c1-6-28(7-2,8-3)27-26(22(4)5)25(24-19-13-10-14-20-24)21-15-18-23-16-11-9-12-17-23/h9-17,19-22,25-26H,6-8,18H2,1-5H3/b21-15-/t25-,26-/m0/s1 |
| InChIKey | UCYOALPIZGGWLZ-OMOZCQPXSA-N |
| XLogP | 7.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|