C27H29BrOSi — CID 10435146
[1-(4-bromophenyl)-2-methylidenebut-3-enoxy]-tert-butyl-diphenylsilane (PubChem CID 10435146) has the molecular formula C27H29BrOSi and a molecular weight of 477.52 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2-methylidenebut-3-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [1-(4-bromophenyl)-2-methylidenebut-3-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10435146 |
| Molecular Formula | C27H29BrOSi |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [1-(4-bromophenyl)-2-methylidenebut-3-enoxy]-tert-butyl-diphenylsilane |
| SMILES | C=CC(=C)C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H29BrOSi/c1-6-21(2)26(22-17-19-23(28)20-18-22)29-30(27(3,4)5,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h6-20,26H,1-2H2,3-5H3 |
| InChIKey | RVEWQFJNDKKMGG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|