C11H14Cl2O3 — CID 137375691
(1R,2R)-1-(3,4-dichlorophenyl)-1-(methoxymethoxy)propan-2-ol (PubChem CID 137375691) has the molecular formula C11H14Cl2O3 and a molecular weight of 265.14 g/mol. Its IUPAC name is (1R,2R)-1-(3,4-dichlorophenyl)-1-(methoxymethoxy)propan-2-ol.
| Compound Name | (1R,2R)-1-(3,4-dichlorophenyl)-1-(methoxymethoxy)propan-2-ol |
|---|---|
| PubChem CID | 137375691 |
| Molecular Formula | C11H14Cl2O3 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (1R,2R)-1-(3,4-dichlorophenyl)-1-(methoxymethoxy)propan-2-ol |
| SMILES | COCO[C@H](c1ccc(Cl)c(Cl)c1)[C@@H](C)O |
| InChI | InChI=1S/C11H14Cl2O3/c1-7(14)11(16-6-15-2)8-3-4-9(12)10(13)5-8/h3-5,7,11,14H,6H2,1-2H3/t7-,11+/m1/s1 |
| InChIKey | JFRVUQMGSYDTMC-HQJQHLMTSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|