C11H15ClO3 — CID 137375754
(1S,2S)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-ol (PubChem CID 137375754) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is (1S,2S)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-ol.
| Compound Name | (1S,2S)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-ol |
|---|---|
| PubChem CID | 137375754 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (1S,2S)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-ol |
| SMILES | COCO[C@@H](c1ccccc1Cl)[C@H](C)O |
| InChI | InChI=1S/C11H15ClO3/c1-8(13)11(15-7-14-2)9-5-3-4-6-10(9)12/h3-6,8,11,13H,7H2,1-2H3/t8-,11+/m0/s1 |
| InChIKey | CJDRXGVOMGDLHU-GZMMTYOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|