C16H21ClO4 — CID 149458940
[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl] 2-cyclopropylacetate (PubChem CID 149458940) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is [(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl] 2-cyclopropylacetate.
| Compound Name | [(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl] 2-cyclopropylacetate |
|---|---|
| PubChem CID | 149458940 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl] 2-cyclopropylacetate |
| SMILES | COCO[C@H](c1ccccc1Cl)[C@@H](C)OC(=O)CC1CC1 |
| InChI | InChI=1S/C16H21ClO4/c1-11(21-15(18)9-12-7-8-12)16(20-10-19-2)13-5-3-4-6-14(13)17/h3-6,11-12,16H,7-10H2,1-2H3/t11-,16+/m1/s1 |
| InChIKey | YZCZJTMLHGLLRO-BZNIZROVSA-N |
| XLogP | 3.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|