About 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine
1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine (PubChem CID 90433394) has the molecular formula C14H20ClNO3
and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine.
Molecular Properties
| Compound Name | 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine |
| PubChem CID | 90433394 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine |
| SMILES | C=C(NC)O[C@H](C)[C@H](OCOC)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO3/c1-10(19-11(2)16-3)14(18-9-17-4)12-7-5-6-8-13(12)15/h5-8,10,14,16H,2,9H2,1,3-4H3/t10-,14+/m1/s1 |
| InChIKey | LLWAVHMTNLGITH-YGRLFVJLSA-N |
| XLogP | 3.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine?
The IUPAC name of 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine (CID 90433394) is 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine.
What is the SMILES notation for 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine?
The canonical SMILES for 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine is C=C(NC)O[C@H](C)[C@H](OCOC)c1ccccc1Cl.
What is the InChIKey of 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine?
The InChIKey is LLWAVHMTNLGITH-YGRLFVJLSA-N. The full InChI is InChI=1S/C14H20ClNO3/c1-10(19-11(2)16-3)14(18-9-17-4)12-7-5-6-8-13(12)15/h5-8,10,14,16H,2,9H2,1,3-4H3/t10-,14+/m1/s1.
What are the key properties of 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine?
1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine has a molecular weight of 285.77 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-1-(2-chlorophenyl)-1-(methoxymethoxy)propan-2-yl]oxy-N-methylethenamine is sourced from PubChem (CID 90433394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).