C16H23FO4 — CID 158510765
[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] 3-methylbutanoate (PubChem CID 158510765) has the molecular formula C16H23FO4 and a molecular weight of 298.35 g/mol. Its IUPAC name is [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] 3-methylbutanoate.
| Compound Name | [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 158510765 |
| Molecular Formula | C16H23FO4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] 3-methylbutanoate |
| SMILES | COCO[C@@H](c1ccccc1F)[C@H](C)OC(=O)CC(C)C |
| InChI | InChI=1S/C16H23FO4/c1-11(2)9-15(18)21-12(3)16(20-10-19-4)13-7-5-6-8-14(13)17/h5-8,11-12,16H,9-10H2,1-4H3/t12-,16+/m0/s1 |
| InChIKey | HLAFNXMEYJBTEU-BLLLJJGKSA-N |
| XLogP | 3.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|