C13H15FO3 — CID 71488457
1-cyclopropyl-2-(2-fluorophenyl)-2-(methoxymethoxy)ethanone (PubChem CID 71488457) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-fluorophenyl)-2-(methoxymethoxy)ethanone.
| Compound Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-(methoxymethoxy)ethanone |
|---|---|
| PubChem CID | 71488457 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-(methoxymethoxy)ethanone |
| SMILES | COCOC(C(=O)C1CC1)c1ccccc1F |
| InChI | InChI=1S/C13H15FO3/c1-16-8-17-13(12(15)9-6-7-9)10-4-2-3-5-11(10)14/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | CLWJQQGJBBLMFV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|