C17H23ClFNOS — CID 18703832
1-cyclopropyl-2-(2-fluorophenyl)-2-[4-(sulfanylmethyl)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 18703832) has the molecular formula C17H23ClFNOS and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-fluorophenyl)-2-[4-(sulfanylmethyl)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[4-(sulfanylmethyl)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 18703832 |
| Molecular Formula | C17H23ClFNOS |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[4-(sulfanylmethyl)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(C1CC1)C(c1ccccc1F)N1CCC(CS)CC1 |
| InChI | InChI=1S/C17H22FNOS.ClH/c18-15-4-2-1-3-14(15)16(17(20)13-5-6-13)19-9-7-12(11-21)8-10-19;/h1-4,12-13,16,21H,5-11H2;1H |
| InChIKey | AQPLJKRSQTUCQL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|