C22H30FNO2S — CID 18703857
S-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-4-yl] hexanethioate (PubChem CID 18703857) has the molecular formula C22H30FNO2S and a molecular weight of 391.55 g/mol. Its IUPAC name is S-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-4-yl] hexanethioate.
| Compound Name | S-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-4-yl] hexanethioate |
|---|---|
| PubChem CID | 18703857 |
| Molecular Formula | C22H30FNO2S |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | S-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-4-yl] hexanethioate |
| SMILES | CCCCCC(=O)SC1CCN(C(C(=O)C2CC2)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H30FNO2S/c1-2-3-4-9-20(25)27-17-12-14-24(15-13-17)21(22(26)16-10-11-16)18-7-5-6-8-19(18)23/h5-8,16-17,21H,2-4,9-15H2,1H3 |
| InChIKey | UETLWTAEOIIHLX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|