C15H17FO2S — CID 140994266
1-cyclopropyl-2-(2-fluorophenyl)-2-(5-hydroxythiolan-2-yl)ethanone (PubChem CID 140994266) has the molecular formula C15H17FO2S and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-fluorophenyl)-2-(5-hydroxythiolan-2-yl)ethanone.
| Compound Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-(5-hydroxythiolan-2-yl)ethanone |
|---|---|
| PubChem CID | 140994266 |
| Molecular Formula | C15H17FO2S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-(5-hydroxythiolan-2-yl)ethanone |
| SMILES | O=C(C1CC1)C(c1ccccc1F)C1CCC(O)S1 |
| InChI | InChI=1S/C15H17FO2S/c16-11-4-2-1-3-10(11)14(15(18)9-5-6-9)12-7-8-13(17)19-12/h1-4,9,12-14,17H,5-8H2 |
| InChIKey | WKXLUYUENYLBCF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |