C19H26FNO4 — CID 123526733
[1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate (PubChem CID 123526733) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate.
| Compound Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate |
|---|---|
| PubChem CID | 123526733 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate |
| SMILES | COCOC(c1ccccc1F)C(C)OC(=O)NC1CC2CCC1C2 |
| InChI | InChI=1S/C19H26FNO4/c1-12(18(24-11-23-2)15-5-3-4-6-16(15)20)25-19(22)21-17-10-13-7-8-14(17)9-13/h3-6,12-14,17-18H,7-11H2,1-2H3,(H,21,22) |
| InChIKey | FDQOVNUYURJLAD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|