C20H29NO4 — CID 123827568
[1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate (PubChem CID 123827568) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate.
| Compound Name | [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate |
|---|---|
| PubChem CID | 123827568 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-(2-bicyclo[2.2.1]heptanyl)carbamate |
| SMILES | COCOC(c1ccccc1C)C(C)OC(=O)NC1CC2CCC1C2 |
| InChI | InChI=1S/C20H29NO4/c1-13-6-4-5-7-17(13)19(24-12-23-3)14(2)25-20(22)21-18-11-15-8-9-16(18)10-15/h4-7,14-16,18-19H,8-12H2,1-3H3,(H,21,22) |
| InChIKey | JZRVMMWWRBRFKE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|