C19H29NO4 — CID 123225281
[1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-cyclohexylcarbamate (PubChem CID 123225281) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-cyclohexylcarbamate.
| Compound Name | [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 123225281 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [1-(methoxymethoxy)-1-(2-methylphenyl)propan-2-yl] N-cyclohexylcarbamate |
| SMILES | COCOC(c1ccccc1C)C(C)OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H29NO4/c1-14-9-7-8-12-17(14)18(23-13-22-3)15(2)24-19(21)20-16-10-5-4-6-11-16/h7-9,12,15-16,18H,4-6,10-11,13H2,1-3H3,(H,20,21) |
| InChIKey | TVGKXIIOZVLYTO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|