C22H31IO4 — CID 161260081
[(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 161260081) has the molecular formula C22H31IO4 and a molecular weight of 486.39 g/mol. Its IUPAC name is [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 161260081 |
| Molecular Formula | C22H31IO4 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [(1S,2S)-1-(2-iodophenyl)-1-(methoxymethoxy)-3-methylbutan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | COCO[C@@H](c1ccccc1I)[C@@H](OC(=O)CC1CC2CCC1C2)C(C)C |
| InChI | InChI=1S/C22H31IO4/c1-14(2)21(22(26-13-25-3)18-6-4-5-7-19(18)23)27-20(24)12-17-11-15-8-9-16(17)10-15/h4-7,14-17,21-22H,8-13H2,1-3H3/t15?,16?,17?,21-,22-/m0/s1 |
| InChIKey | VCKYLSFSYMOVNI-JUJMVNKHSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|