C18H23IO3 — CID 148534603
[(1S,2S)-1-hydroxy-1-(2-iodophenyl)propan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 148534603) has the molecular formula C18H23IO3 and a molecular weight of 414.28 g/mol. Its IUPAC name is [(1S,2S)-1-hydroxy-1-(2-iodophenyl)propan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | [(1S,2S)-1-hydroxy-1-(2-iodophenyl)propan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 148534603 |
| Molecular Formula | C18H23IO3 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [(1S,2S)-1-hydroxy-1-(2-iodophenyl)propan-2-yl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | C[C@H](OC(=O)CC1CC2CCC1C2)[C@@H](O)c1ccccc1I |
| InChI | InChI=1S/C18H23IO3/c1-11(18(21)15-4-2-3-5-16(15)19)22-17(20)10-14-9-12-6-7-13(14)8-12/h2-5,11-14,18,21H,6-10H2,1H3/t11-,12?,13?,14?,18+/m0/s1 |
| InChIKey | MQYHXBYJPLTOLC-ZZJMGNLHSA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|