C16H24ClNO4 — CID 123237058
[3-(2-chlorophenyl)-3-(methoxymethoxy)-2-methylpropyl] N-propan-2-ylcarbamate (PubChem CID 123237058) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-3-(methoxymethoxy)-2-methylpropyl] N-propan-2-ylcarbamate.
| Compound Name | [3-(2-chlorophenyl)-3-(methoxymethoxy)-2-methylpropyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 123237058 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [3-(2-chlorophenyl)-3-(methoxymethoxy)-2-methylpropyl] N-propan-2-ylcarbamate |
| SMILES | COCOC(c1ccccc1Cl)C(C)COC(=O)NC(C)C |
| InChI | InChI=1S/C16H24ClNO4/c1-11(2)18-16(19)21-9-12(3)15(22-10-20-4)13-7-5-6-8-14(13)17/h5-8,11-12,15H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | RCOJRQZCTOZRAC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|