C14H20ClNO3 — CID 144705888
[(1R)-1-(2-chlorophenyl)-1-methoxypropan-2-yl] N-propan-2-ylcarbamate (PubChem CID 144705888) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-1-methoxypropan-2-yl] N-propan-2-ylcarbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)-1-methoxypropan-2-yl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 144705888 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-1-methoxypropan-2-yl] N-propan-2-ylcarbamate |
| SMILES | CO[C@H](c1ccccc1Cl)C(C)OC(=O)NC(C)C |
| InChI | InChI=1S/C14H20ClNO3/c1-9(2)16-14(17)19-10(3)13(18-4)11-7-5-6-8-12(11)15/h5-10,13H,1-4H3,(H,16,17)/t10?,13-/m0/s1 |
| InChIKey | FSGQEHWLAKCDFJ-HQVZTVAUSA-N |
| XLogP | 3.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |