C19H30ClNO4 — CID 123499796
[1-(2-chlorophenyl)-1-(1-methoxypentoxy)propan-2-yl] N-propylcarbamate (PubChem CID 123499796) has the molecular formula C19H30ClNO4 and a molecular weight of 371.91 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-1-(1-methoxypentoxy)propan-2-yl] N-propylcarbamate.
| Compound Name | [1-(2-chlorophenyl)-1-(1-methoxypentoxy)propan-2-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 123499796 |
| Molecular Formula | C19H30ClNO4 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [1-(2-chlorophenyl)-1-(1-methoxypentoxy)propan-2-yl] N-propylcarbamate |
| SMILES | CCCCC(OC)OC(c1ccccc1Cl)C(C)OC(=O)NCCC |
| InChI | InChI=1S/C19H30ClNO4/c1-5-7-12-17(23-4)25-18(15-10-8-9-11-16(15)20)14(3)24-19(22)21-13-6-2/h8-11,14,17-18H,5-7,12-13H2,1-4H3,(H,21,22) |
| InChIKey | NMHXONXDVTYPQP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|