C12H14Cl2O3 — CID 118683201
[(1S,2S)-1-(2,3-dichlorophenyl)-1-methoxypropan-2-yl] acetate (PubChem CID 118683201) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is [(1S,2S)-1-(2,3-dichlorophenyl)-1-methoxypropan-2-yl] acetate.
| Compound Name | [(1S,2S)-1-(2,3-dichlorophenyl)-1-methoxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 118683201 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [(1S,2S)-1-(2,3-dichlorophenyl)-1-methoxypropan-2-yl] acetate |
| SMILES | CO[C@@H](c1cccc(Cl)c1Cl)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C12H14Cl2O3/c1-7(17-8(2)15)12(16-3)9-5-4-6-10(13)11(9)14/h4-7,12H,1-3H3/t7-,12+/m0/s1 |
| InChIKey | KPFRPFUBMDKLTR-JVXZTZIISA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |