C13H18Cl2O3 — CID 137375637
1-(2,6-dichlorophenyl)-1-(methoxymethoxy)-3-methylbutan-2-ol (PubChem CID 137375637) has the molecular formula C13H18Cl2O3 and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-1-(methoxymethoxy)-3-methylbutan-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-1-(methoxymethoxy)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 137375637 |
| Molecular Formula | C13H18Cl2O3 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-1-(methoxymethoxy)-3-methylbutan-2-ol |
| SMILES | COCOC(c1c(Cl)cccc1Cl)C(O)C(C)C |
| InChI | InChI=1S/C13H18Cl2O3/c1-8(2)12(16)13(18-7-17-3)11-9(14)5-4-6-10(11)15/h4-6,8,12-13,16H,7H2,1-3H3 |
| InChIKey | JBYNWWZHWKODPS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|