C12H18ClNO — CID 131371288
(1R,2S)-1-amino-1-(2-chloro-6-methylphenyl)-3-methylbutan-2-ol (PubChem CID 131371288) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2-chloro-6-methylphenyl)-3-methylbutan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2-chloro-6-methylphenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 131371288 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1R,2S)-1-amino-1-(2-chloro-6-methylphenyl)-3-methylbutan-2-ol |
| SMILES | Cc1cccc(Cl)c1[C@@H](N)[C@@H](O)C(C)C |
| InChI | InChI=1S/C12H18ClNO/c1-7(2)12(15)11(14)10-8(3)5-4-6-9(10)13/h4-7,11-12,15H,14H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | HHEAXCNZYQQIFO-NEPJUHHUSA-N |
| XLogP | 2.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |