C11H16ClNO2 — CID 131290563
2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-6-chlorophenol (PubChem CID 131290563) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-6-chlorophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-6-chlorophenol |
|---|---|
| PubChem CID | 131290563 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-methylbutyl]-6-chlorophenol |
| SMILES | CC(C)[C@@H](O)[C@@H](N)c1cccc(Cl)c1O |
| InChI | InChI=1S/C11H16ClNO2/c1-6(2)10(14)9(13)7-4-3-5-8(12)11(7)15/h3-6,9-10,14-15H,13H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | DZINNCXATUVOQI-VHSXEESVSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|