C12H19Cl2NO2 — CID 171262416
2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-chlorophenol;hydrochloride (PubChem CID 171262416) has the molecular formula C12H19Cl2NO2 and a molecular weight of 280.19 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-chlorophenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-chlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171262416 |
| Molecular Formula | C12H19Cl2NO2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-6-chlorophenol;hydrochloride |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1cccc(Cl)c1O.Cl |
| InChI | InChI=1S/C12H18ClNO2.ClH/c1-3-7(2)11(15)10(14)8-5-4-6-9(13)12(8)16;/h4-7,10-11,15-16H,3,14H2,1-2H3;1H/t7?,10-,11+;/m1./s1 |
| InChIKey | YUBSWQGOSUIPHL-VPCSKREWSA-N |
| XLogP | 2.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|