C11H15ClO2 — CID 90430903
(1S,2S)-1-(2-chloro-6-methylphenyl)-2-methoxypropan-1-ol (PubChem CID 90430903) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is (1S,2S)-1-(2-chloro-6-methylphenyl)-2-methoxypropan-1-ol.
| Compound Name | (1S,2S)-1-(2-chloro-6-methylphenyl)-2-methoxypropan-1-ol |
|---|---|
| PubChem CID | 90430903 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1S,2S)-1-(2-chloro-6-methylphenyl)-2-methoxypropan-1-ol |
| SMILES | CO[C@@H](C)[C@@H](O)c1c(C)cccc1Cl |
| InChI | InChI=1S/C11H15ClO2/c1-7-5-4-6-9(12)10(7)11(13)8(2)14-3/h4-6,8,11,13H,1-3H3/t8-,11+/m0/s1 |
| InChIKey | HZOGJCGKMBMHMR-GZMMTYOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |