C12H17Cl2NO5S — CID 139319432
[(1S,2S)-1-(2,6-dichlorophenyl)-1-(methoxymethoxy)butan-2-yl] sulfamate (PubChem CID 139319432) has the molecular formula C12H17Cl2NO5S and a molecular weight of 358.24 g/mol. Its IUPAC name is [(1S,2S)-1-(2,6-dichlorophenyl)-1-(methoxymethoxy)butan-2-yl] sulfamate.
| Compound Name | [(1S,2S)-1-(2,6-dichlorophenyl)-1-(methoxymethoxy)butan-2-yl] sulfamate |
|---|---|
| PubChem CID | 139319432 |
| Molecular Formula | C12H17Cl2NO5S |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [(1S,2S)-1-(2,6-dichlorophenyl)-1-(methoxymethoxy)butan-2-yl] sulfamate |
| SMILES | CC[C@H](OS(N)(=O)=O)[C@@H](OCOC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO5S/c1-3-10(20-21(15,16)17)12(19-7-18-2)11-8(13)5-4-6-9(11)14/h4-6,10,12H,3,7H2,1-2H3,(H2,15,16,17)/t10-,12+/m0/s1 |
| InChIKey | RLDWBFRJQLDSID-CMPLNLGQSA-N |
| XLogP | 2.65 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|