C11H13Cl2NO3 — CID 130340375
[(2S)-1-(2,6-dichlorophenyl)-2-hydroxybutyl] carbamate (PubChem CID 130340375) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is [(2S)-1-(2,6-dichlorophenyl)-2-hydroxybutyl] carbamate.
| Compound Name | [(2S)-1-(2,6-dichlorophenyl)-2-hydroxybutyl] carbamate |
|---|---|
| PubChem CID | 130340375 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [(2S)-1-(2,6-dichlorophenyl)-2-hydroxybutyl] carbamate |
| SMILES | CC[C@H](O)C(OC(N)=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO3/c1-2-8(15)10(17-11(14)16)9-6(12)4-3-5-7(9)13/h3-5,8,10,15H,2H2,1H3,(H2,14,16)/t8-,10?/m0/s1 |
| InChIKey | WXEOUKRIEUCMIN-PEHGTWAWSA-N |
| XLogP | 2.90 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |