C13H16Cl2O3 — CID 58594548
[(3S)-2-hydroxy-3-methylpentyl] 2,6-dichlorobenzoate (PubChem CID 58594548) has the molecular formula C13H16Cl2O3 and a molecular weight of 291.17 g/mol. Its IUPAC name is [(3S)-2-hydroxy-3-methylpentyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-2-hydroxy-3-methylpentyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 58594548 |
| Molecular Formula | C13H16Cl2O3 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [(3S)-2-hydroxy-3-methylpentyl] 2,6-dichlorobenzoate |
| SMILES | CC[C@H](C)C(O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O3/c1-3-8(2)11(16)7-18-13(17)12-9(14)5-4-6-10(12)15/h4-6,8,11,16H,3,7H2,1-2H3/t8-,11?/m0/s1 |
| InChIKey | ATZUCHJZZMPWAH-YMNIQAILSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |