C12H15Cl2NO3 — CID 58594566
[(3S)-3-amino-2-hydroxypentyl] 2,6-dichlorobenzoate (PubChem CID 58594566) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is [(3S)-3-amino-2-hydroxypentyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-3-amino-2-hydroxypentyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 58594566 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | [(3S)-3-amino-2-hydroxypentyl] 2,6-dichlorobenzoate |
| SMILES | CC[C@H](N)C(O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO3/c1-2-9(15)10(16)6-18-12(17)11-7(13)4-3-5-8(11)14/h3-5,9-10,16H,2,6,15H2,1H3/t9-,10?/m0/s1 |
| InChIKey | SBAILSDRBSPZRL-RGURZIINSA-N |
| XLogP | 2.25 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |