C13H15Cl2NO3 — CID 59924094
[(3S)-3-(methylamino)-2-oxopentyl] 2,6-dichlorobenzoate (PubChem CID 59924094) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is [(3S)-3-(methylamino)-2-oxopentyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-3-(methylamino)-2-oxopentyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 59924094 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | [(3S)-3-(methylamino)-2-oxopentyl] 2,6-dichlorobenzoate |
| SMILES | CC[C@H](NC)C(=O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3/c1-3-10(16-2)11(17)7-19-13(18)12-8(14)5-4-6-9(12)15/h4-6,10,16H,3,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | MTILQPVXYOHMLH-JTQLQIEISA-N |
| XLogP | 2.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |