C19H19Cl2NO7 — CID 89029863
[(3S)-2,5-dioxo-3-(prop-2-enoxycarbonylamino)-5-prop-1-en-2-yloxypentyl] 2,6-dichlorobenzoate (PubChem CID 89029863) has the molecular formula C19H19Cl2NO7 and a molecular weight of 444.27 g/mol. Its IUPAC name is [(3S)-2,5-dioxo-3-(prop-2-enoxycarbonylamino)-5-prop-1-en-2-yloxypentyl] 2,6-dichlorobenzoate.
| Compound Name | [(3S)-2,5-dioxo-3-(prop-2-enoxycarbonylamino)-5-prop-1-en-2-yloxypentyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 89029863 |
| Molecular Formula | C19H19Cl2NO7 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | [(3S)-2,5-dioxo-3-(prop-2-enoxycarbonylamino)-5-prop-1-en-2-yloxypentyl] 2,6-dichlorobenzoate |
| SMILES | C=CCOC(=O)N[C@@H](CC(=O)OC(=C)C)C(=O)COC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H19Cl2NO7/c1-4-8-27-19(26)22-14(9-16(24)29-11(2)3)15(23)10-28-18(25)17-12(20)6-5-7-13(17)21/h4-7,14H,1-2,8-10H2,3H3,(H,22,26)/t14-/m0/s1 |
| InChIKey | PBCNZPCKSCCERK-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|