C20H26ClNO6 — CID 18465758
tert-butyl 5-[(2-chlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate (PubChem CID 18465758) has the molecular formula C20H26ClNO6 and a molecular weight of 411.88 g/mol. Its IUPAC name is tert-butyl 5-[(2-chlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl 5-[(2-chlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 18465758 |
| Molecular Formula | C20H26ClNO6 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | tert-butyl 5-[(2-chlorophenyl)methoxy]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate |
| SMILES | C=CCOC(=O)NC(CC(=O)OC(C)(C)C)C(=O)COCc1ccccc1Cl |
| InChI | InChI=1S/C20H26ClNO6/c1-5-10-27-19(25)22-16(11-18(24)28-20(2,3)4)17(23)13-26-12-14-8-6-7-9-15(14)21/h5-9,16H,1,10-13H2,2-4H3,(H,22,25) |
| InChIKey | CYOQWDCKZLZSLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|