About ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate
ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate (PubChem CID 18726330) has the molecular formula C19H21Cl2N5O5
and a molecular weight of 470.31 g/mol. Its IUPAC name is ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate.
Molecular Properties
| Compound Name | ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate |
| PubChem CID | 18726330 |
| Molecular Formula | C19H21Cl2N5O5 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate |
| SMILES | C=CCOC(=O)NC(CC(=O)OCC)C(=O)Cn1nnc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C19H21Cl2N5O5/c1-3-8-31-19(29)22-15(10-18(28)30-4-2)16(27)11-26-24-17(23-25-26)9-12-13(20)6-5-7-14(12)21/h3,5-7,15H,1,4,8-11H2,2H3,(H,22,29) |
| InChIKey | ONNTWCVZDZLIEF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate?
The IUPAC name of ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate (CID 18726330) is ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate.
What is the SMILES notation for ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate?
The canonical SMILES for ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate is C=CCOC(=O)NC(CC(=O)OCC)C(=O)Cn1nnc(Cc2c(Cl)cccc2Cl)n1.
What is the InChIKey of ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate?
The InChIKey is ONNTWCVZDZLIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2N5O5/c1-3-8-31-19(29)22-15(10-18(28)30-4-2)16(27)11-26-24-17(23-25-26)9-12-13(20)6-5-7-14(12)21/h3,5-7,15H,1,4,8-11H2,2H3,(H,22,29).
What are the key properties of ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate?
ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate has a molecular weight of 470.31 g/mol, XLogP of 2.37, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxo-3-(prop-2-enoxycarbonylamino)pentanoate is sourced from PubChem (CID 18726330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).