C23H25Cl2N5O6S — CID 22614575
3-[(4-butoxyphenyl)sulfonylamino]-5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxopentanoic acid (PubChem CID 22614575) has the molecular formula C23H25Cl2N5O6S and a molecular weight of 570.46 g/mol. Its IUPAC name is 3-[(4-butoxyphenyl)sulfonylamino]-5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxopentanoic acid.
| Compound Name | 3-[(4-butoxyphenyl)sulfonylamino]-5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 22614575 |
| Molecular Formula | C23H25Cl2N5O6S |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 3-[(4-butoxyphenyl)sulfonylamino]-5-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-4-oxopentanoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC(CC(=O)O)C(=O)Cn2nnc(Cc3c(Cl)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C23H25Cl2N5O6S/c1-2-3-11-36-15-7-9-16(10-8-15)37(34,35)28-20(13-23(32)33)21(31)14-30-27-22(26-29-30)12-17-18(24)5-4-6-19(17)25/h4-10,20,28H,2-3,11-14H2,1H3,(H,32,33) |
| InChIKey | IISWKKFZJJFIKS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|