C24H28Cl2N6O3 — CID 18725897
2-[4-(dimethylamino)phenyl]ethyl N-[1-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18725897) has the molecular formula C24H28Cl2N6O3 and a molecular weight of 519.43 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]ethyl N-[1-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-2-oxopentan-3-yl]carbamate.
| Compound Name | 2-[4-(dimethylamino)phenyl]ethyl N-[1-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18725897 |
| Molecular Formula | C24H28Cl2N6O3 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]ethyl N-[1-[5-[(2,6-dichlorophenyl)methyl]tetrazol-2-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)OCCc1ccc(N(C)C)cc1)C(=O)Cn1nnc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C24H28Cl2N6O3/c1-4-21(27-24(34)35-13-12-16-8-10-17(11-9-16)31(2)3)22(33)15-32-29-23(28-30-32)14-18-19(25)6-5-7-20(18)26/h5-11,21H,4,12-15H2,1-3H3,(H,27,34) |
| InChIKey | YALSUKKAGZKPMG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|