methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate

C14H14Cl2O3 — CID 162067314

IUPACmethyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate
SMILESC=CCC(CC(=O)c1c(Cl)cccc1Cl)C(=O)OC
InChIInChI=1S/C14H14Cl2O3/c1-3-5-9(14(18)19-2)8-12(17)13-10(15)6-4-7-11(13)16/h3-4,6-7,9H,1,5,8H2,2H3
InChIKeyZAPXHKJKNAMAAC-UHFFFAOYSA-N
MW301.17 g/mol
LogP3.93
Rot. Bonds6

About methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate

methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate (PubChem CID 162067314) has the molecular formula C14H14Cl2O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate.

Molecular Properties

Compound Namemethyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate
PubChem CID162067314
Molecular FormulaC14H14Cl2O3
Molecular Weight301.17 g/mol
Exact Mass300.03
IUPAC Namemethyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate
SMILESC=CCC(CC(=O)c1c(Cl)cccc1Cl)C(=O)OC
InChIInChI=1S/C14H14Cl2O3/c1-3-5-9(14(18)19-2)8-12(17)13-10(15)6-4-7-11(13)16/h3-4,6-7,9H,1,5,8H2,2H3
InChIKeyZAPXHKJKNAMAAC-UHFFFAOYSA-N
XLogP3.93
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.17
LogP ≤ 53.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate?
The IUPAC name of methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate (CID 162067314) is methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate.
What is the SMILES notation for methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate?
The canonical SMILES for methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate is C=CCC(CC(=O)c1c(Cl)cccc1Cl)C(=O)OC.
What is the InChIKey of methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate?
The InChIKey is ZAPXHKJKNAMAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2O3/c1-3-5-9(14(18)19-2)8-12(17)13-10(15)6-4-7-11(13)16/h3-4,6-7,9H,1,5,8H2,2H3.
What are the key properties of methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate?
methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate has a molecular weight of 301.17 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2,6-dichlorophenyl)-2-oxoethyl]pent-4-enoate is sourced from PubChem (CID 162067314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).