C13H19Cl2NO3 — CID 126633859
(1S,2S)-1-[amino(hydroxy)methoxy]-1-(2,6-dichlorophenyl)hexan-2-ol (PubChem CID 126633859) has the molecular formula C13H19Cl2NO3 and a molecular weight of 308.20 g/mol. Its IUPAC name is (1S,2S)-1-[amino(hydroxy)methoxy]-1-(2,6-dichlorophenyl)hexan-2-ol.
| Compound Name | (1S,2S)-1-[amino(hydroxy)methoxy]-1-(2,6-dichlorophenyl)hexan-2-ol |
|---|---|
| PubChem CID | 126633859 |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (1S,2S)-1-[amino(hydroxy)methoxy]-1-(2,6-dichlorophenyl)hexan-2-ol |
| SMILES | CCCC[C@H](O)[C@@H](OC(N)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H19Cl2NO3/c1-2-3-7-10(17)12(19-13(16)18)11-8(14)5-4-6-9(11)15/h4-6,10,12-13,17-18H,2-3,7,16H2,1H3/t10-,12+,13?/m0/s1 |
| InChIKey | IFTBPDMWVWKLSY-LQNXFFKNSA-N |
| XLogP | 2.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|