C11H15ClFNO — CID 171161505
(1S,2R)-1-amino-1-(2-chloro-6-fluorophenyl)pentan-2-ol (PubChem CID 171161505) has the molecular formula C11H15ClFNO and a molecular weight of 231.70 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2-chloro-6-fluorophenyl)pentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2-chloro-6-fluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 171161505 |
| Molecular Formula | C11H15ClFNO |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (1S,2R)-1-amino-1-(2-chloro-6-fluorophenyl)pentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1c(F)cccc1Cl |
| InChI | InChI=1S/C11H15ClFNO/c1-2-4-9(15)11(14)10-7(12)5-3-6-8(10)13/h3,5-6,9,11,15H,2,4,14H2,1H3/t9-,11-/m1/s1 |
| InChIKey | KDJCLTVDWJZVRZ-MWLCHTKSSA-N |
| XLogP | 2.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |