C12H17Cl2F2NO — CID 171263824
(1R,2S)-1-amino-1-(3-chloro-2,6-difluorophenyl)hexan-2-ol;hydrochloride (PubChem CID 171263824) has the molecular formula C12H17Cl2F2NO and a molecular weight of 300.18 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-chloro-2,6-difluorophenyl)hexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(3-chloro-2,6-difluorophenyl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263824 |
| Molecular Formula | C12H17Cl2F2NO |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-chloro-2,6-difluorophenyl)hexan-2-ol;hydrochloride |
| SMILES | CCCC[C@H](O)[C@H](N)c1c(F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C12H16ClF2NO.ClH/c1-2-3-4-9(17)12(16)10-8(14)6-5-7(13)11(10)15;/h5-6,9,12,17H,2-4,16H2,1H3;1H/t9-,12-;/m0./s1 |
| InChIKey | YVIQLOWXOZRHDL-CSDGMEMJSA-N |
| XLogP | 3.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|