C12H18Cl3NO2 — CID 171265912
2-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dichlorophenol;hydrochloride (PubChem CID 171265912) has the molecular formula C12H18Cl3NO2 and a molecular weight of 314.64 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dichlorophenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dichlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171265912 |
| Molecular Formula | C12H18Cl3NO2 |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxyhexyl]-3,5-dichlorophenol;hydrochloride |
| SMILES | CCCC[C@H](O)[C@H](N)c1c(O)cc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C12H17Cl2NO2.ClH/c1-2-3-4-9(16)12(15)11-8(14)5-7(13)6-10(11)17;/h5-6,9,12,16-17H,2-4,15H2,1H3;1H/t9-,12-;/m0./s1 |
| InChIKey | NAWNFQAWDFEGKW-CSDGMEMJSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|