C9H11Cl2NO2 — CID 131173726
2-[(1S,2R)-1-amino-2-hydroxypropyl]-3,5-dichlorophenol (PubChem CID 131173726) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxypropyl]-3,5-dichlorophenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-3,5-dichlorophenol |
|---|---|
| PubChem CID | 131173726 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxypropyl]-3,5-dichlorophenol |
| SMILES | C[C@@H](O)[C@@H](N)c1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO2/c1-4(13)9(12)8-6(11)2-5(10)3-7(8)14/h2-4,9,13-14H,12H2,1H3/t4-,9-/m1/s1 |
| InChIKey | GVGPTQSOVPRPCP-ALFREKQPSA-N |
| XLogP | 2.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|