C8H8Cl2O2 — CID 130032494
3,5-dichloro-2-(1-hydroxyethyl)phenol (PubChem CID 130032494) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is 3,5-dichloro-2-(1-hydroxyethyl)phenol.
| Compound Name | 3,5-dichloro-2-(1-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 130032494 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3,5-dichloro-2-(1-hydroxyethyl)phenol |
| SMILES | CC(O)c1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O2/c1-4(11)8-6(10)2-5(9)3-7(8)12/h2-4,11-12H,1H3 |
| InChIKey | YAQXHSKAKXOEKH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |