C10H13ClO2 — CID 82265408
4-chloro-2-(1-hydroxyethyl)-3,5-dimethylphenol (PubChem CID 82265408) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 4-chloro-2-(1-hydroxyethyl)-3,5-dimethylphenol.
| Compound Name | 4-chloro-2-(1-hydroxyethyl)-3,5-dimethylphenol |
|---|---|
| PubChem CID | 82265408 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-chloro-2-(1-hydroxyethyl)-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(C(C)O)c(C)c1Cl |
| InChI | InChI=1S/C10H13ClO2/c1-5-4-8(13)9(7(3)12)6(2)10(5)11/h4,7,12-13H,1-3H3 |
| InChIKey | DVTYZTCBDRQQRZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |