C12H19Cl2NO2 — CID 171267478
4-[(1S,2R)-1-amino-2-hydroxyhexyl]-2-chlorophenol;hydrochloride (PubChem CID 171267478) has the molecular formula C12H19Cl2NO2 and a molecular weight of 280.19 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-hydroxyhexyl]-2-chlorophenol;hydrochloride.
| Compound Name | 4-[(1S,2R)-1-amino-2-hydroxyhexyl]-2-chlorophenol;hydrochloride |
|---|---|
| PubChem CID | 171267478 |
| Molecular Formula | C12H19Cl2NO2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-hydroxyhexyl]-2-chlorophenol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1ccc(O)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H18ClNO2.ClH/c1-2-3-4-11(16)12(14)8-5-6-10(15)9(13)7-8;/h5-7,11-12,15-16H,2-4,14H2,1H3;1H/t11-,12+;/m1./s1 |
| InChIKey | OEGFTWKNURDHDW-LYCTWNKOSA-N |
| XLogP | 3.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |