C12H19ClINO — CID 171267629
(1S,2R)-1-amino-1-(4-iodophenyl)hexan-2-ol;hydrochloride (PubChem CID 171267629) has the molecular formula C12H19ClINO and a molecular weight of 355.65 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(4-iodophenyl)hexan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(4-iodophenyl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171267629 |
| Molecular Formula | C12H19ClINO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (1S,2R)-1-amino-1-(4-iodophenyl)hexan-2-ol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1ccc(I)cc1.Cl |
| InChI | InChI=1S/C12H18INO.ClH/c1-2-3-4-11(15)12(14)9-5-7-10(13)8-6-9;/h5-8,11-12,15H,2-4,14H2,1H3;1H/t11-,12+;/m1./s1 |
| InChIKey | WLYXDPMNEKYOAK-LYCTWNKOSA-N |
| XLogP | 3.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|