C14H21ClN2O — CID 171262623
(1R,2S)-1-amino-1-(1H-indol-6-yl)hexan-2-ol;hydrochloride (PubChem CID 171262623) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(1H-indol-6-yl)hexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(1H-indol-6-yl)hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171262623 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(1H-indol-6-yl)hexan-2-ol;hydrochloride |
| SMILES | CCCC[C@H](O)[C@H](N)c1ccc2cc[nH]c2c1.Cl |
| InChI | InChI=1S/C14H20N2O.ClH/c1-2-3-4-13(17)14(15)11-6-5-10-7-8-16-12(10)9-11;/h5-9,13-14,16-17H,2-4,15H2,1H3;1H/t13-,14+;/m0./s1 |
| InChIKey | LKTQKDQWBPYCHN-LMRHVHIWSA-N |
| XLogP | 3.14 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |