C12H20ClNO3 — CID 171266833
5-[(1S,2R)-1-amino-2-hydroxyhexyl]benzene-1,3-diol;hydrochloride (PubChem CID 171266833) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is 5-[(1S,2R)-1-amino-2-hydroxyhexyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 5-[(1S,2R)-1-amino-2-hydroxyhexyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171266833 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 5-[(1S,2R)-1-amino-2-hydroxyhexyl]benzene-1,3-diol;hydrochloride |
| SMILES | CCCC[C@@H](O)[C@@H](N)c1cc(O)cc(O)c1.Cl |
| InChI | InChI=1S/C12H19NO3.ClH/c1-2-3-4-11(16)12(13)8-5-9(14)7-10(15)6-8;/h5-7,11-12,14-16H,2-4,13H2,1H3;1H/t11-,12+;/m1./s1 |
| InChIKey | AEZAADFWSWIXDI-LYCTWNKOSA-N |
| XLogP | 2.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |